ChemNet > CAS > 249278-25-9 1-[2-hydroxy-6-(isopentyloxy)phenyl]ethan-1-one
249278-25-9 1-[2-hydroxy-6-(isopentyloxy)phenyl]ethan-1-one
| product Name |
1-[2-hydroxy-6-(isopentyloxy)phenyl]ethan-1-one |
| CAS No |
249278-25-9 |
| Synonyms |
1-[2-hydroxy-6-(3-methylbutoxy)phenyl]ethanone |
| Molecular Formula |
C13H18O3 |
| Molecular Weight |
222.2802 |
| InChI |
InChI=1/C13H18O3/c1-9(2)7-8-16-12-6-4-5-11(15)13(12)10(3)14/h4-6,9,15H,7-8H2,1-3H3 |
| Molecular Structure |
![249278-25-9 1-[2-hydroxy-6-(isopentyloxy)phenyl]ethan-1-one](https://images-a.chemnet.com/suppliers/chembase/294/29423.gif)
|
| Density |
1.059g/cm3 |
| Melting point |
25℃ |
| Boiling point |
328°C at 760 mmHg |
| Refractive index |
1.515 |
| Flash point |
118.2°C |
| Vapour Pressur |
0.000102mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
